| Name | 1-ethoxyethylideneammonium chloride |
| Synonyms | EAH EthyliminoacetateHCl ETHYL ACETAMIDATE HCL ETHYL ACETIMIDATE HCL ACETIMIDIC ACID ETHYL ESTER ETHYL ACETIMIDATE HYDROCHLORIDE Ethyl acetimidate hydrochloride 1-ethoxyethylideneammonium chloride |
| CAS | 2208-07-3 |
| EINECS | 218-631-7 |
| InChI | InChI=1/C4H9NO.ClH/c1-3-6-4(2)5;/h5H,3H2,1-2H3;1H |
| InChIKey | WGMHMVLZFAJNOT-UHFFFAOYSA-N |
| Molecular Formula | C4H10ClNO |
| Molar Mass | 123.58 |
| Melting Point | 112-114°C(lit.) |
| Boling Point | 57.3℃ at 760 mmHg |
| Water Solubility | Soluble in water (50mg/L). |
| Solubility | water: soluble50mg/mL, clear, colorless |
| Appearance | White to light yellow crystal powder |
| Color | White |
| BRN | 3552401 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Stability | Hygroscopic, Moisture Sensitive |
| Sensitive | Moisture Sensitive |
| MDL | MFCD00012572 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 3-10-21 |
| TSCA | Yes |
| HS Code | 29252900 |
| Hazard Class | IRRITANT |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |